C16H24Cl2N2O — CID 60926174
3-[1-(2,4-dichlorophenyl)propylamino]-N,N-diethylpropanamide (PubChem CID 60926174) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)propylamino]-N,N-diethylpropanamide.
| Compound Name | 3-[1-(2,4-dichlorophenyl)propylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 60926174 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)propylamino]-N,N-diethylpropanamide |
| SMILES | CCC(NCCC(=O)N(CC)CC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O/c1-4-15(13-8-7-12(17)11-14(13)18)19-10-9-16(21)20(5-2)6-3/h7-8,11,15,19H,4-6,9-10H2,1-3H3 |
| InChIKey | URCGKMJCOHHVDG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |