C16H24Cl2N2 — CID 63454306
1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)propan-1-amine (PubChem CID 63454306) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)propan-1-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)propan-1-amine |
|---|---|
| PubChem CID | 63454306 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(2-piperidin-1-ylethyl)propan-1-amine |
| SMILES | CCC(NCCN1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2/c1-2-16(14-7-6-13(17)12-15(14)18)19-8-11-20-9-4-3-5-10-20/h6-7,12,16,19H,2-5,8-11H2,1H3 |
| InChIKey | PXKZETWNDOXDNE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |