C15H21Cl2NO — CID 65105429
1-[[1-(2,4-dichlorophenyl)propylamino]methyl]cyclopentan-1-ol (PubChem CID 65105429) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-[[1-(2,4-dichlorophenyl)propylamino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[1-(2,4-dichlorophenyl)propylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65105429 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-[[1-(2,4-dichlorophenyl)propylamino]methyl]cyclopentan-1-ol |
| SMILES | CCC(NCC1(O)CCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2NO/c1-2-14(12-6-5-11(16)9-13(12)17)18-10-15(19)7-3-4-8-15/h5-6,9,14,18-19H,2-4,7-8,10H2,1H3 |
| InChIKey | AGLGDFDUSYNEKI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |