C16H22FN3O5Si — CID 173350686
3-(4-fluorophenyl)-2-methyl-4-silyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;oxalic acid (PubChem CID 173350686) has the molecular formula C16H22FN3O5Si and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-methyl-4-silyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;oxalic acid.
| Compound Name | 3-(4-fluorophenyl)-2-methyl-4-silyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;oxalic acid |
|---|---|
| PubChem CID | 173350686 |
| Molecular Formula | C16H22FN3O5Si |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-(4-fluorophenyl)-2-methyl-4-silyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;oxalic acid |
| SMILES | CC([SiH3])C(O)(c1ccc(F)cc1)C(C)(C)n1cncn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20FN3OSi.C2H2O4/c1-10(20)14(19,11-4-6-12(15)7-5-11)13(2,3)18-9-16-8-17-18;3-1(4)2(5)6/h4-10,19H,1-3,20H3;(H,3,4)(H,5,6) |
| InChIKey | CMLKZIZMCPRHNT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|