C11H21N3 — CID 170045826
1-(2,3,3,4-tetramethylpentan-2-yl)-1,2,4-triazole (PubChem CID 170045826) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(2,3,3,4-tetramethylpentan-2-yl)-1,2,4-triazole.
| Compound Name | 1-(2,3,3,4-tetramethylpentan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 170045826 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(2,3,3,4-tetramethylpentan-2-yl)-1,2,4-triazole |
| SMILES | CC(C)C(C)(C)C(C)(C)n1cncn1 |
| InChI | InChI=1S/C11H21N3/c1-9(2)10(3,4)11(5,6)14-8-12-7-13-14/h7-9H,1-6H3 |
| InChIKey | LCCVPNVIBDDOEX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |