C6H9N3NaO2- — CID 140668472
sodium;2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one;hydroxide (PubChem CID 140668472) has the molecular formula C6H9N3NaO2- and a molecular weight of 178.15 g/mol. Its IUPAC name is sodium;2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one;hydroxide.
| Compound Name | sodium;2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one;hydroxide |
|---|---|
| PubChem CID | 140668472 |
| Molecular Formula | C6H9N3NaO2- |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | sodium;2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one;hydroxide |
| SMILES | CC(C)([C-]=O)n1cncn1.[Na+].[OH-] |
| InChI | InChI=1S/C6H8N3O.Na.H2O/c1-6(2,3-10)9-5-7-4-8-9;;/h4-5H,1-2H3;;1H2/q-1;+1;/p-1 |
| InChIKey | PMGYBXXMIOZZRB-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|