C13H23N5 — CID 159959105
3-tert-butyl-4H-pyrazole;1-tert-butyl-1,2,4-triazole (PubChem CID 159959105) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-tert-butyl-4H-pyrazole;1-tert-butyl-1,2,4-triazole.
| Compound Name | 3-tert-butyl-4H-pyrazole;1-tert-butyl-1,2,4-triazole |
|---|---|
| PubChem CID | 159959105 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 3-tert-butyl-4H-pyrazole;1-tert-butyl-1,2,4-triazole |
| SMILES | CC(C)(C)C1=NN=CC1.CC(C)(C)n1cncn1 |
| InChI | InChI=1S/C7H12N2.C6H11N3/c1-7(2,3)6-4-5-8-9-6;1-6(2,3)9-5-7-4-8-9/h5H,4H2,1-3H3;4-5H,1-3H3 |
| InChIKey | ODCBSLXDDYYMFR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |