C18H27FN3O4P — CID 70423350
[2-butyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)hexyl]phosphonic acid (PubChem CID 70423350) has the molecular formula C18H27FN3O4P and a molecular weight of 399.40 g/mol. Its IUPAC name is [2-butyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)hexyl]phosphonic acid.
| Compound Name | [2-butyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 70423350 |
| Molecular Formula | C18H27FN3O4P |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [2-butyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)hexyl]phosphonic acid |
| SMILES | CCCCC(CCCC)(n1cncn1)C(O)(c1ccc(F)cc1)P(=O)(O)O |
| InChI | InChI=1S/C18H27FN3O4P/c1-3-5-11-17(12-6-4-2,22-14-20-13-21-22)18(23,27(24,25)26)15-7-9-16(19)10-8-15/h7-10,13-14,23H,3-6,11-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | LCLLPKHPMFNMIX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|