C14H19FN3O4P — CID 70423511
[2-ethyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)butyl]phosphonic acid (PubChem CID 70423511) has the molecular formula C14H19FN3O4P and a molecular weight of 343.29 g/mol. Its IUPAC name is [2-ethyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)butyl]phosphonic acid.
| Compound Name | [2-ethyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)butyl]phosphonic acid |
|---|---|
| PubChem CID | 70423511 |
| Molecular Formula | C14H19FN3O4P |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | [2-ethyl-1-(4-fluorophenyl)-1-hydroxy-2-(1,2,4-triazol-1-yl)butyl]phosphonic acid |
| SMILES | CCC(CC)(n1cncn1)C(O)(c1ccc(F)cc1)P(=O)(O)O |
| InChI | InChI=1S/C14H19FN3O4P/c1-3-13(4-2,18-10-16-9-17-18)14(19,23(20,21)22)11-5-7-12(15)8-6-11/h5-10,19H,3-4H2,1-2H3,(H2,20,21,22) |
| InChIKey | LDYVTWKELAMQDV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|