C12H11Cl3FN3O2 — CID 12902589
4,4,4-trichloro-1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)butane-1,3-diol (PubChem CID 12902589) has the molecular formula C12H11Cl3FN3O2 and a molecular weight of 354.60 g/mol. Its IUPAC name is 4,4,4-trichloro-1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)butane-1,3-diol.
| Compound Name | 4,4,4-trichloro-1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 12902589 |
| Molecular Formula | C12H11Cl3FN3O2 |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4,4,4-trichloro-1-(4-fluorophenyl)-2-(1,2,4-triazol-1-yl)butane-1,3-diol |
| SMILES | OC(c1ccc(F)cc1)C(C(O)C(Cl)(Cl)Cl)n1cncn1 |
| InChI | InChI=1S/C12H11Cl3FN3O2/c13-12(14,15)11(21)9(19-6-17-5-18-19)10(20)7-1-3-8(16)4-2-7/h1-6,9-11,20-21H |
| InChIKey | RUSZOUUYOLMETM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|