C16H16F2N4Si — CID 174818079
1-[[amino-[bis(4-fluorophenyl)methyl]silyl]methyl]-1,2,4-triazole (PubChem CID 174818079) has the molecular formula C16H16F2N4Si and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-[[amino-[bis(4-fluorophenyl)methyl]silyl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[amino-[bis(4-fluorophenyl)methyl]silyl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 174818079 |
| Molecular Formula | C16H16F2N4Si |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-[[amino-[bis(4-fluorophenyl)methyl]silyl]methyl]-1,2,4-triazole |
| SMILES | N[SiH](Cn1cncn1)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16F2N4Si/c17-14-5-1-12(2-6-14)16(13-3-7-15(18)8-4-13)23(19)11-22-10-20-9-21-22/h1-10,16,23H,11,19H2 |
| InChIKey | WTXKAIQFQDXVPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|