C17H17F2N3Si — CID 154489904
bis(4-fluorophenyl)-methyl-[2-(1,2,4-triazol-1-yl)ethyl]silane (PubChem CID 154489904) has the molecular formula C17H17F2N3Si and a molecular weight of 329.43 g/mol. Its IUPAC name is bis(4-fluorophenyl)-methyl-[2-(1,2,4-triazol-1-yl)ethyl]silane.
| Compound Name | bis(4-fluorophenyl)-methyl-[2-(1,2,4-triazol-1-yl)ethyl]silane |
|---|---|
| PubChem CID | 154489904 |
| Molecular Formula | C17H17F2N3Si |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | bis(4-fluorophenyl)-methyl-[2-(1,2,4-triazol-1-yl)ethyl]silane |
| SMILES | C[Si](CCn1cncn1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17F2N3Si/c1-23(11-10-22-13-20-12-21-22,16-6-2-14(18)3-7-16)17-8-4-15(19)5-9-17/h2-9,12-13H,10-11H2,1H3 |
| InChIKey | QIQUEUDMXPDOOJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|