C10H12FN3Si — CID 150513747
(4-fluorophenyl)methyl-(1,2,4-triazol-1-ylmethyl)silane (PubChem CID 150513747) has the molecular formula C10H12FN3Si and a molecular weight of 221.31 g/mol. Its IUPAC name is (4-fluorophenyl)methyl-(1,2,4-triazol-1-ylmethyl)silane.
| Compound Name | (4-fluorophenyl)methyl-(1,2,4-triazol-1-ylmethyl)silane |
|---|---|
| PubChem CID | 150513747 |
| Molecular Formula | C10H12FN3Si |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | (4-fluorophenyl)methyl-(1,2,4-triazol-1-ylmethyl)silane |
| SMILES | Fc1ccc(C[SiH2]Cn2cncn2)cc1 |
| InChI | InChI=1S/C10H12FN3Si/c11-10-3-1-9(2-4-10)5-15-8-14-7-12-6-13-14/h1-4,6-7H,5,8,15H2 |
| InChIKey | IAJXFNGKZLQMKC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|