C13H14FN3 — CID 23274489
1-[[1-(4-fluorophenyl)cyclobutyl]methyl]-1,2,4-triazole (PubChem CID 23274489) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)cyclobutyl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[1-(4-fluorophenyl)cyclobutyl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23274489 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)cyclobutyl]methyl]-1,2,4-triazole |
| SMILES | Fc1ccc(C2(Cn3cncn3)CCC2)cc1 |
| InChI | InChI=1S/C13H14FN3/c14-12-4-2-11(3-5-12)13(6-1-7-13)8-17-10-15-9-16-17/h2-5,9-10H,1,6-8H2 |
| InChIKey | ZBXWCTNPFZQLEZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |