C14H15F2N3O — CID 172701548
1-[[2-(2,4-difluorophenyl)oxan-2-yl]methyl]-1,2,4-triazole (PubChem CID 172701548) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-[[2-(2,4-difluorophenyl)oxan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2,4-difluorophenyl)oxan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 172701548 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-[[2-(2,4-difluorophenyl)oxan-2-yl]methyl]-1,2,4-triazole |
| SMILES | Fc1ccc(C2(Cn3cncn3)CCCCO2)c(F)c1 |
| InChI | InChI=1S/C14H15F2N3O/c15-11-3-4-12(13(16)7-11)14(5-1-2-6-20-14)8-19-10-17-9-18-19/h3-4,7,9-10H,1-2,5-6,8H2 |
| InChIKey | DAMBGUVUFQFFFP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |