C20H20ClF2N3O5S — CID 87639214
4-chlorobenzenesulfonic acid;[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol (PubChem CID 87639214) has the molecular formula C20H20ClF2N3O5S and a molecular weight of 487.91 g/mol. Its IUPAC name is 4-chlorobenzenesulfonic acid;[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol.
| Compound Name | 4-chlorobenzenesulfonic acid;[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 87639214 |
| Molecular Formula | C20H20ClF2N3O5S |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 4-chlorobenzenesulfonic acid;[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol |
| SMILES | O=S(=O)(O)c1ccc(Cl)cc1.OC[C@@H]1CO[C@@](Cn2cncn2)(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H15F2N3O2.C6H5ClO3S/c15-11-1-2-12(13(16)3-11)14(4-10(5-20)6-21-14)7-19-9-17-8-18-19;7-5-1-3-6(4-2-5)11(8,9)10/h1-3,8-10,20H,4-7H2;1-4H,(H,8,9,10)/t10-,14+;/m1./s1 |
| InChIKey | GIDFILUOQUDELA-LOSLGVLSSA-N |
| XLogP | 3.07 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|