C24H21F2N3O4S — CID 23377515
[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methyl naphthalene-2-sulfonate (PubChem CID 23377515) has the molecular formula C24H21F2N3O4S and a molecular weight of 485.51 g/mol. Its IUPAC name is [(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methyl naphthalene-2-sulfonate.
| Compound Name | [(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methyl naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 23377515 |
| Molecular Formula | C24H21F2N3O4S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methyl naphthalene-2-sulfonate |
| SMILES | O=S(=O)(OC[C@H]1CO[C@@](Cn2cncn2)(c2ccc(F)cc2F)C1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H21F2N3O4S/c25-20-6-8-22(23(26)10-20)24(14-29-16-27-15-28-29)11-17(12-32-24)13-33-34(30,31)21-7-5-18-3-1-2-4-19(18)9-21/h1-10,15-17H,11-14H2/t17-,24+/m1/s1 |
| InChIKey | BHGHHPHGOXQGDQ-OSPHWJPCSA-N |
| XLogP | 4.05 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|