C20H19F2N3O5S — CID 11308088
[(2S,4R)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11308088) has the molecular formula C20H19F2N3O5S and a molecular weight of 451.45 g/mol. Its IUPAC name is [(2S,4R)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11308088 |
| Molecular Formula | C20H19F2N3O5S |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [(2S,4R)-4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC[C@](Cn3cncn3)(c3ccc(F)cc3F)O2)cc1 |
| InChI | InChI=1S/C20H19F2N3O5S/c1-14-2-5-16(6-3-14)31(26,27)29-9-19-28-11-20(30-19,10-25-13-23-12-24-25)17-7-4-15(21)8-18(17)22/h2-8,12-13,19H,9-11H2,1H3/t19-,20+/m0/s1 |
| InChIKey | BCUQQLHIHZDUTG-VQTJNVASSA-N |
| XLogP | 2.54 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|