C19H23F2N3O4S — CID 14329870
6-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]hexanoic acid (PubChem CID 14329870) has the molecular formula C19H23F2N3O4S and a molecular weight of 427.47 g/mol. Its IUPAC name is 6-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]hexanoic acid.
| Compound Name | 6-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 14329870 |
| Molecular Formula | C19H23F2N3O4S |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 6-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]hexanoic acid |
| SMILES | O=C(O)CCCCCSCC1OCC(Cn2cncn2)(c2ccc(F)cc2F)O1 |
| InChI | InChI=1S/C19H23F2N3O4S/c20-14-5-6-15(16(21)8-14)19(10-24-13-22-12-23-24)11-27-18(28-19)9-29-7-3-1-2-4-17(25)26/h5-6,8,12-13,18H,1-4,7,9-11H2,(H,25,26) |
| InChIKey | NIGOEAYHMSDUBL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|