C36H42F2N8O3S — CID 91190733
3-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-2-yl]pentan-2-ol (PubChem CID 91190733) has the molecular formula C36H42F2N8O3S and a molecular weight of 704.85 g/mol. Its IUPAC name is 3-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-2-yl]pentan-2-ol.
| Compound Name | 3-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-2-yl]pentan-2-ol |
|---|---|
| PubChem CID | 91190733 |
| Molecular Formula | C36H42F2N8O3S |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | 3-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]methylsulfanyl]phenyl]piperazin-1-yl]phenyl]-3H-1,2,4-triazol-2-yl]pentan-2-ol |
| SMILES | CCC(C(C)O)N1CN(c2ccc(N3CCN(c4ccc(SCC5OCC(Cn6cncn6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)C=N1 |
| InChI | InChI=1S/C36H42F2N8O3S/c1-3-34(26(2)47)46-25-44(24-41-46)30-7-5-28(6-8-30)42-14-16-43(17-15-42)29-9-11-31(12-10-29)50-19-35-48-21-36(49-35,20-45-23-39-22-40-45)32-13-4-27(37)18-33(32)38/h4-13,18,22-24,26,34-35,47H,3,14-17,19-21,25H2,1-2H3 |
| InChIKey | JVKSHGAGQVCODH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|