C34H33F2N9O3S — CID 46183520
2-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]sulfanylmethyl]phenyl]piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]propanenitrile (PubChem CID 46183520) has the molecular formula C34H33F2N9O3S and a molecular weight of 685.76 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]sulfanylmethyl]phenyl]piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]propanenitrile.
| Compound Name | 2-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]sulfanylmethyl]phenyl]piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 46183520 |
| Molecular Formula | C34H33F2N9O3S |
| Molecular Weight | 685.76 g/mol |
| Exact Mass | 685.24 |
| IUPAC Name | 2-[4-[4-[4-[4-[[4-(2,4-difluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-yl]sulfanylmethyl]phenyl]piperazin-1-yl]phenyl]-5-oxo-1,2,4-triazol-1-yl]propanenitrile |
| SMILES | CC(C#N)n1ncn(-c2ccc(N3CCN(c4ccc(CSC5OCC(Cn6cncn6)(c6ccc(F)cc6F)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C34H33F2N9O3S/c1-24(17-37)45-32(46)44(23-40-45)29-9-7-28(8-10-29)42-14-12-41(13-15-42)27-5-2-25(3-6-27)18-49-33-47-20-34(48-33,19-43-22-38-21-39-43)30-11-4-26(35)16-31(30)36/h2-11,16,21-24,33H,12-15,18-20H2,1H3 |
| InChIKey | RKXJPDPQCWJIRC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 119.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|