C20H18BrF2N3O4S — CID 101184576
[(2S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methyl 4-bromobenzenesulfonate (PubChem CID 101184576) has the molecular formula C20H18BrF2N3O4S and a molecular weight of 514.35 g/mol. Its IUPAC name is [(2S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methyl 4-bromobenzenesulfonate.
| Compound Name | [(2S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methyl 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 101184576 |
| Molecular Formula | C20H18BrF2N3O4S |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | [(2S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-2-yl]methyl 4-bromobenzenesulfonate |
| SMILES | O=S(=O)(OC[C@@H]1CC[C@@](Cn2cncn2)(c2ccc(F)cc2F)O1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrF2N3O4S/c21-14-1-4-17(5-2-14)31(27,28)29-10-16-7-8-20(30-16,11-26-13-24-12-25-26)18-6-3-15(22)9-19(18)23/h1-6,9,12-13,16H,7-8,10-11H2/t16-,20+/m0/s1 |
| InChIKey | RLUIUDYFHACCHD-OXJNMPFZSA-N |
| XLogP | 3.80 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|