C13H10F2N6O — CID 11833631
1-[(2R,3R)-3-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-ylmethyl)oxiran-2-yl]-1,2,4-triazole (PubChem CID 11833631) has the molecular formula C13H10F2N6O and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-ylmethyl)oxiran-2-yl]-1,2,4-triazole.
| Compound Name | 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-ylmethyl)oxiran-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 11833631 |
| Molecular Formula | C13H10F2N6O |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[(2R,3R)-3-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-ylmethyl)oxiran-2-yl]-1,2,4-triazole |
| SMILES | Fc1ccc([C@]2(Cn3cncn3)O[C@H]2n2cncn2)c(F)c1 |
| InChI | InChI=1S/C13H10F2N6O/c14-9-1-2-10(11(15)3-9)13(4-20-7-16-5-18-20)12(22-13)21-8-17-6-19-21/h1-3,5-8,12H,4H2/t12-,13+/m1/s1 |
| InChIKey | OKWPLXVWPUQCLY-OLZOCXBDSA-N |
| XLogP | 1.27 |
| TPSA | 73.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|