C18H14F3N3O — CID 23634496
1-[[(2S,3R)-3-(2-methylphenyl)-2-(2,4,5-trifluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 23634496) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-[[(2S,3R)-3-(2-methylphenyl)-2-(2,4,5-trifluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[(2S,3R)-3-(2-methylphenyl)-2-(2,4,5-trifluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23634496 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-[[(2S,3R)-3-(2-methylphenyl)-2-(2,4,5-trifluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Cc1ccccc1[C@H]1O[C@]1(Cn1cncn1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H14F3N3O/c1-11-4-2-3-5-12(11)17-18(25-17,8-24-10-22-9-23-24)13-6-15(20)16(21)7-14(13)19/h2-7,9-10,17H,8H2,1H3/t17-,18-/m1/s1 |
| InChIKey | AOLYLHZXJWNPGJ-QZTJIDSGSA-N |
| XLogP | 3.67 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|