C17H12Cl3N3O — CID 87405820
1-[[2-(2-chlorophenyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 87405820) has the molecular formula C17H12Cl3N3O and a molecular weight of 380.66 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[2-(2-chlorophenyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 87405820 |
| Molecular Formula | C17H12Cl3N3O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 1-[[2-(2-chlorophenyl)-3-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Clc1ccc(C2OC2(Cn2cncn2)c2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl3N3O/c18-11-5-6-12(15(20)7-11)16-17(24-16,8-23-10-21-9-22-23)13-3-1-2-4-14(13)19/h1-7,9-10,16H,8H2 |
| InChIKey | WPWWMIVFZBWQLH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|