C18H15F2N3O — CID 86648918
1-[[(2S,3R)-2-(3,4-difluorophenyl)-3-(2-methylphenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 86648918) has the molecular formula C18H15F2N3O and a molecular weight of 327.33 g/mol. Its IUPAC name is 1-[[(2S,3R)-2-(3,4-difluorophenyl)-3-(2-methylphenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[(2S,3R)-2-(3,4-difluorophenyl)-3-(2-methylphenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 86648918 |
| Molecular Formula | C18H15F2N3O |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[[(2S,3R)-2-(3,4-difluorophenyl)-3-(2-methylphenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Cc1ccccc1[C@H]1O[C@]1(Cn1cncn1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H15F2N3O/c1-12-4-2-3-5-14(12)17-18(24-17,9-23-11-21-10-22-23)13-6-7-15(19)16(20)8-13/h2-8,10-11,17H,9H2,1H3/t17-,18-/m1/s1 |
| InChIKey | NTWXWBLMULTCHS-QZTJIDSGSA-N |
| XLogP | 3.53 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|