C18H12F3N3O3 — CID 23729127
1-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 23729127) has the molecular formula C18H12F3N3O3 and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23729127 |
| Molecular Formula | C18H12F3N3O3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-[[3-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Fc1ccc(C2(Cn3cncn3)OC2c2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C18H12F3N3O3/c19-13-4-2-12(3-5-13)17(8-24-10-22-9-23-24)16(27-17)11-1-6-14-15(7-11)26-18(20,21)25-14/h1-7,9-10,16H,8H2 |
| InChIKey | CDIWLNQMHMNEKW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|