C14H15F2N3O — CID 57226351
1-[[(2R,3S,4R)-2-(2,4-difluorophenyl)-3,4-dimethyloxetan-2-yl]methyl]-1,2,4-triazole (PubChem CID 57226351) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-[[(2R,3S,4R)-2-(2,4-difluorophenyl)-3,4-dimethyloxetan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[(2R,3S,4R)-2-(2,4-difluorophenyl)-3,4-dimethyloxetan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 57226351 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-[[(2R,3S,4R)-2-(2,4-difluorophenyl)-3,4-dimethyloxetan-2-yl]methyl]-1,2,4-triazole |
| SMILES | C[C@H]1O[C@@](Cn2cncn2)(c2ccc(F)cc2F)[C@H]1C |
| InChI | InChI=1S/C14H15F2N3O/c1-9-10(2)20-14(9,6-19-8-17-7-18-19)12-4-3-11(15)5-13(12)16/h3-5,7-10H,6H2,1-2H3/t9-,10+,14+/m0/s1 |
| InChIKey | DCUJMYPWIXWLDD-IMSIIYSGSA-N |
| XLogP | 2.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |