C21H16F6N4O2 — CID 102059564
[(4S,5S)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[2-fluoro-4-(trifluoromethyl)phenyl]methanone (PubChem CID 102059564) has the molecular formula C21H16F6N4O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is [(4S,5S)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[2-fluoro-4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4S,5S)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[2-fluoro-4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 102059564 |
| Molecular Formula | C21H16F6N4O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | [(4S,5S)-5-(2,4-difluorophenyl)-4-methyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]-[2-fluoro-4-(trifluoromethyl)phenyl]methanone |
| SMILES | C[C@@H]1N(C(=O)c2ccc(C(F)(F)F)cc2F)CO[C@]1(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H16F6N4O2/c1-12-20(8-30-10-28-9-29-30,16-5-3-14(22)7-18(16)24)33-11-31(12)19(32)15-4-2-13(6-17(15)23)21(25,26)27/h2-7,9-10,12H,8,11H2,1H3/t12-,20-/m0/s1 |
| InChIKey | HUYVBHGQQBHTSN-YUNKPMOVSA-N |
| XLogP | 4.13 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |