C14H15F2N3O3S — CID 139662978
(2R,3S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)-1,4-oxathiane 4,4-dioxide (PubChem CID 139662978) has the molecular formula C14H15F2N3O3S and a molecular weight of 343.36 g/mol. Its IUPAC name is (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)-1,4-oxathiane 4,4-dioxide.
| Compound Name | (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)-1,4-oxathiane 4,4-dioxide |
|---|---|
| PubChem CID | 139662978 |
| Molecular Formula | C14H15F2N3O3S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2R,3S)-2-(2,4-difluorophenyl)-3-methyl-2-(1,2,4-triazol-1-ylmethyl)-1,4-oxathiane 4,4-dioxide |
| SMILES | C[C@H]1[C@](Cn2cncn2)(c2ccc(F)cc2F)OCCS1(=O)=O |
| InChI | InChI=1S/C14H15F2N3O3S/c1-10-14(7-19-9-17-8-18-19,22-4-5-23(10,20)21)12-3-2-11(15)6-13(12)16/h2-3,6,8-10H,4-5,7H2,1H3/t10-,14+/m0/s1 |
| InChIKey | OKYXNOPGSPOEQP-IINYFYTJSA-N |
| XLogP | 1.29 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |