C14H16Cl2N4O — CID 67821810
(4R,5R)-5-(2,4-dichlorophenyl)-2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidine (PubChem CID 67821810) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is (4R,5R)-5-(2,4-dichlorophenyl)-2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidine.
| Compound Name | (4R,5R)-5-(2,4-dichlorophenyl)-2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 67821810 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (4R,5R)-5-(2,4-dichlorophenyl)-2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)-1,3-oxazolidine |
| SMILES | CC1N[C@H](C)[C@](Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C14H16Cl2N4O/c1-9-14(21-10(2)19-9,6-20-8-17-7-18-20)12-4-3-11(15)5-13(12)16/h3-5,7-10,19H,6H2,1-2H3/t9-,10?,14-/m1/s1 |
| InChIKey | ANDCLRMGXYAMCT-KWBIFUEGSA-N |
| XLogP | 2.83 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |