C18H13Cl2N3O3 — CID 13422749
4,5-bis(3-chlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one (PubChem CID 13422749) has the molecular formula C18H13Cl2N3O3 and a molecular weight of 390.23 g/mol. Its IUPAC name is 4,5-bis(3-chlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one.
| Compound Name | 4,5-bis(3-chlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 13422749 |
| Molecular Formula | C18H13Cl2N3O3 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 4,5-bis(3-chlorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OC(c2cccc(Cl)c2)C(Cn2cncn2)(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C18H13Cl2N3O3/c19-14-5-1-3-12(7-14)16-18(26-17(24)25-16,9-23-11-21-10-22-23)13-4-2-6-15(20)8-13/h1-8,10-11,16H,9H2 |
| InChIKey | VXUWLZQPINPMDL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |