C30H30F2N6O4 — CID 134990256
1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]-4-(4-nitrophenyl)piperazine (PubChem CID 134990256) has the molecular formula C30H30F2N6O4 and a molecular weight of 576.60 g/mol. Its IUPAC name is 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 134990256 |
| Molecular Formula | C30H30F2N6O4 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]phenyl]-4-(4-nitrophenyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5cncn5)(c5ccc(F)cc5F)C4)cc3)CC2)cc1 |
| InChI | InChI=1S/C30H30F2N6O4/c31-23-1-10-28(29(32)15-23)30(19-37-21-33-20-34-37)16-22(18-42-30)17-41-27-8-6-25(7-9-27)36-13-11-35(12-14-36)24-2-4-26(5-3-24)38(39)40/h1-10,15,20-22H,11-14,16-19H2/t22-,30+/m1/s1 |
| InChIKey | MSKDCNFPYVYHAW-RCRUUEGKSA-N |
| XLogP | 4.80 |
| TPSA | 98.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|