C32H35F2N5O2 — CID 145189457
1-[4-[[5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine (PubChem CID 145189457) has the molecular formula C32H35F2N5O2 and a molecular weight of 559.66 g/mol. Its IUPAC name is 1-[4-[[5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine.
| Compound Name | 1-[4-[[5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine |
|---|---|
| PubChem CID | 145189457 |
| Molecular Formula | C32H35F2N5O2 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 1-[4-[[5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine |
| SMILES | Cc1ccc(N2CCN(c3ccc(OCC4COC(Cn5cncn5)(c5ccc(F)cc5F)C4)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C32H35F2N5O2/c1-23-3-6-27(7-4-23)37-11-13-38(14-12-37)28-8-10-31(24(2)15-28)40-18-25-17-32(41-19-25,20-39-22-35-21-36-39)29-9-5-26(33)16-30(29)34/h3-10,15-16,21-22,25H,11-14,17-20H2,1-2H3 |
| InChIKey | PLPHDFMYEWNUMY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|