C38H36F4N6O3 — CID 121384812
N-(2,5-difluorophenyl)-4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]piperazin-1-yl]benzamide (PubChem CID 121384812) has the molecular formula C38H36F4N6O3 and a molecular weight of 700.74 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]piperazin-1-yl]benzamide.
| Compound Name | N-(2,5-difluorophenyl)-4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 121384812 |
| Molecular Formula | C38H36F4N6O3 |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-[4-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]piperazin-1-yl]benzamide |
| SMILES | Cc1cc(N2CCN(c3ccc(C(=O)Nc4cc(F)ccc4F)cc3)CC2)ccc1OC[C@@H]1CO[C@@](Cn2cncn2)(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C38H36F4N6O3/c1-25-16-31(47-14-12-46(13-15-47)30-6-2-27(3-7-30)37(49)45-35-18-29(40)5-10-33(35)41)8-11-36(25)50-20-26-19-38(51-21-26,22-48-24-43-23-44-48)32-9-4-28(39)17-34(32)42/h2-11,16-18,23-24,26H,12-15,19-22H2,1H3,(H,45,49)/t26-,38+/m1/s1 |
| InChIKey | IXNBZAZJWNIJPC-BVFDSDPOSA-N |
| XLogP | 6.73 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|