C41H46F2N6O3 — CID 157327040
1-[[(2R,4R)-2-(2,4-difluorophenyl)-4-[(2,4-dimethylphenoxy)methyl]oxolan-2-yl]methyl]-1,2,4-triazole;N-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 157327040) has the molecular formula C41H46F2N6O3 and a molecular weight of 708.85 g/mol. Its IUPAC name is 1-[[(2R,4R)-2-(2,4-difluorophenyl)-4-[(2,4-dimethylphenoxy)methyl]oxolan-2-yl]methyl]-1,2,4-triazole;N-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 1-[[(2R,4R)-2-(2,4-difluorophenyl)-4-[(2,4-dimethylphenoxy)methyl]oxolan-2-yl]methyl]-1,2,4-triazole;N-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 157327040 |
| Molecular Formula | C41H46F2N6O3 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.36 |
| IUPAC Name | 1-[[(2R,4R)-2-(2,4-difluorophenyl)-4-[(2,4-dimethylphenoxy)methyl]oxolan-2-yl]methyl]-1,2,4-triazole;N-(4-methylphenyl)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(N3CCN(C)CC3)cc2)cc1.Cc1ccc(OC[C@@H]2CO[C@@](Cn3cncn3)(c3ccc(F)cc3F)C2)c(C)c1 |
| InChI | InChI=1S/C22H23F2N3O2.C19H23N3O/c1-15-3-6-21(16(2)7-15)28-10-17-9-22(29-11-17,12-27-14-25-13-26-27)19-5-4-18(23)8-20(19)24;1-15-3-7-17(8-4-15)20-19(23)16-5-9-18(10-6-16)22-13-11-21(2)12-14-22/h3-8,13-14,17H,9-12H2,1-2H3;3-10H,11-14H2,1-2H3,(H,20,23)/t17-,22+;/m1./s1 |
| InChIKey | BEVVIKRMHXAQPA-YITVUBHWSA-N |
| XLogP | 7.18 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |