C32H30F2N6O4 — CID 140930169
4-[4-[4-[[(3S,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-isocyanophenyl]piperazin-1-yl]benzoic acid (PubChem CID 140930169) has the molecular formula C32H30F2N6O4 and a molecular weight of 600.63 g/mol. Its IUPAC name is 4-[4-[4-[[(3S,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-isocyanophenyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[4-[[(3S,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-isocyanophenyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 140930169 |
| Molecular Formula | C32H30F2N6O4 |
| Molecular Weight | 600.63 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 4-[4-[4-[[(3S,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-isocyanophenyl]piperazin-1-yl]benzoic acid |
| SMILES | [C-]#[N+]c1cc(N2CCN(c3ccc(C(=O)O)cc3)CC2)ccc1OC[C@@H]1CO[C@@](Cn2cncn2)(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C32H30F2N6O4/c1-35-29-15-26(39-12-10-38(11-13-39)25-5-2-23(3-6-25)31(41)42)7-9-30(29)43-17-22-16-32(44-18-22,19-40-21-36-20-37-40)27-8-4-24(33)14-28(27)34/h2-9,14-15,20-22H,10-13,16-19H2,(H,41,42)/t22-,32+/m1/s1 |
| InChIKey | UNCXCGUADYGIOY-KCEHZKJRSA-N |
| XLogP | 5.14 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|