C35H43F2N5O2 — CID 159036248
1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine;propane (PubChem CID 159036248) has the molecular formula C35H43F2N5O2 and a molecular weight of 603.76 g/mol. Its IUPAC name is 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine;propane.
| Compound Name | 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine;propane |
|---|---|
| PubChem CID | 159036248 |
| Molecular Formula | C35H43F2N5O2 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 1-[4-[[(3R,5R)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methoxy]-3-methylphenyl]-4-(4-methylphenyl)piperazine;propane |
| SMILES | CCC.Cc1ccc(N2CCN(c3ccc(OC[C@@H]4CO[C@@](Cn5cncn5)(c5ccc(F)cc5F)C4)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C32H35F2N5O2.C3H8/c1-23-3-6-27(7-4-23)37-11-13-38(14-12-37)28-8-10-31(24(2)15-28)40-18-25-17-32(41-19-25,20-39-22-35-21-36-39)29-9-5-26(33)16-30(29)34;1-3-2/h3-10,15-16,21-22,25H,11-14,17-20H2,1-2H3;3H2,1-2H3/t25-,32+;/m1./s1 |
| InChIKey | JVMKSONGEILYCI-ZZKNCSOMSA-N |
| XLogP | 6.93 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|