C14H20FN3Si — CID 13474640
butyl-(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane (PubChem CID 13474640) has the molecular formula C14H20FN3Si and a molecular weight of 277.42 g/mol. Its IUPAC name is butyl-(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane.
| Compound Name | butyl-(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane |
|---|---|
| PubChem CID | 13474640 |
| Molecular Formula | C14H20FN3Si |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | butyl-(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane |
| SMILES | CCCC[Si](C)(Cn1cncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3Si/c1-3-4-9-19(2,12-18-11-16-10-17-18)14-7-5-13(15)6-8-14/h5-8,10-11H,3-4,9,12H2,1-2H3 |
| InChIKey | DKHXNBLFTOKGOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|