C41H63F2N3O7Si — CID 67702309
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;[(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] (Z)-2-methyloctadec-9-enoate (PubChem CID 67702309) has the molecular formula C41H63F2N3O7Si and a molecular weight of 776.05 g/mol. Its IUPAC name is bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;[(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] (Z)-2-methyloctadec-9-enoate.
| Compound Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;[(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] (Z)-2-methyloctadec-9-enoate |
|---|---|
| PubChem CID | 67702309 |
| Molecular Formula | C41H63F2N3O7Si |
| Molecular Weight | 776.05 g/mol |
| Exact Mass | 775.44 |
| IUPAC Name | bis(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silane;[(2R,3R,4R,5S)-1,2,4,5,6-pentahydroxyhexan-3-yl] (Z)-2-methyloctadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(C)C(=O)O[C@@H]([C@H](O)[C@@H](O)CO)[C@H](O)CO.C[Si](Cn1cncn1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H48O7.C16H15F2N3Si/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(2)25(31)32-24(22(29)19-27)23(30)21(28)18-26;1-22(12-21-11-19-10-20-21,15-6-2-13(17)3-7-15)16-8-4-14(18)5-9-16/h10-11,20-24,26-30H,3-9,12-19H2,1-2H3;2-11H,12H2,1H3/b11-10-;/t20?,21-,22+,23+,24+;/m0./s1 |
| InChIKey | SCTHGPKARIRJEU-BVXPZDCHSA-N |
| XLogP | 5.24 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|