C39H74O4 — CID 90771679
2,3-dihydroxypropyl 2-hexadec-7-enylicos-11-enoate (PubChem CID 90771679) has the molecular formula C39H74O4 and a molecular weight of 607.02 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-hexadec-7-enylicos-11-enoate.
| Compound Name | 2,3-dihydroxypropyl 2-hexadec-7-enylicos-11-enoate |
|---|---|
| PubChem CID | 90771679 |
| Molecular Formula | C39H74O4 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.56 |
| IUPAC Name | 2,3-dihydroxypropyl 2-hexadec-7-enylicos-11-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCCC(CCCCCCC=CCCCCCCCC)C(=O)OCC(O)CO |
| InChI | InChI=1S/C39H74O4/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-37(39(42)43-36-38(41)35-40)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h17-19,21,37-38,40-41H,3-16,20,22-36H2,1-2H3 |
| InChIKey | SGOPCVOVWFGYFV-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|