C24H46O6 — CID 90745019
(2R,3R,4S)-1,2,3,4,6-pentahydroxytetracos-15-en-5-one (PubChem CID 90745019) has the molecular formula C24H46O6 and a molecular weight of 430.63 g/mol. Its IUPAC name is (2R,3R,4S)-1,2,3,4,6-pentahydroxytetracos-15-en-5-one.
| Compound Name | (2R,3R,4S)-1,2,3,4,6-pentahydroxytetracos-15-en-5-one |
|---|---|
| PubChem CID | 90745019 |
| Molecular Formula | C24H46O6 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (2R,3R,4S)-1,2,3,4,6-pentahydroxytetracos-15-en-5-one |
| SMILES | CCCCCCCCC=CCCCCCCCCC(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H46O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(26)22(28)24(30)23(29)21(27)19-25/h9-10,20-21,23-27,29-30H,2-8,11-19H2,1H3/t20?,21-,23-,24-/m1/s1 |
| InChIKey | CTHIBYABPPUORJ-OGRSYXOCSA-N |
| XLogP | 3.42 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|