C12H22O8 — CID 123563472
(9S,10R,11R)-7,9,10,11,12-pentahydroxy-8-oxododecanoic acid (PubChem CID 123563472) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is (9S,10R,11R)-7,9,10,11,12-pentahydroxy-8-oxododecanoic acid.
| Compound Name | (9S,10R,11R)-7,9,10,11,12-pentahydroxy-8-oxododecanoic acid |
|---|---|
| PubChem CID | 123563472 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (9S,10R,11R)-7,9,10,11,12-pentahydroxy-8-oxododecanoic acid |
| SMILES | O=C(O)CCCCCC(O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O8/c13-6-8(15)11(19)12(20)10(18)7(14)4-2-1-3-5-9(16)17/h7-8,11-15,19-20H,1-6H2,(H,16,17)/t7?,8-,11-,12-/m1/s1 |
| InChIKey | XSTOQMVDOOOODF-WNQFRZNLSA-N |
| XLogP | -1.97 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|