C42H72O10 — CID 141133574
bis(2,3-dihydroxypropanoyl) 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-[(Z)-hexadec-7-enyl]butanedioate (PubChem CID 141133574) has the molecular formula C42H72O10 and a molecular weight of 737.03 g/mol. Its IUPAC name is bis(2,3-dihydroxypropanoyl) 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-[(Z)-hexadec-7-enyl]butanedioate.
| Compound Name | bis(2,3-dihydroxypropanoyl) 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-[(Z)-hexadec-7-enyl]butanedioate |
|---|---|
| PubChem CID | 141133574 |
| Molecular Formula | C42H72O10 |
| Molecular Weight | 737.03 g/mol |
| Exact Mass | 736.51 |
| IUPAC Name | bis(2,3-dihydroxypropanoyl) 2-[(7Z,10Z)-hexadeca-7,10-dienyl]-3-[(Z)-hexadec-7-enyl]butanedioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C(=O)OC(=O)C(O)CO)C(CCCCCC/C=C\CCCCCCCC)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C42H72O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35(39(47)51-41(49)37(45)33-43)36(40(48)52-42(50)38(46)34-44)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,35-38,43-46H,3-10,12,14-16,21-34H2,1-2H3/b13-11-,19-17-,20-18- |
| InChIKey | DUPNLEQULGXGRZ-LTEAFHAISA-N |
| XLogP | 8.14 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.03 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|