C29H54O4 — CID 87880915
(12Z,15Z)-5,6-dibutyl-1,2,3-trihydroxyhenicosa-12,15-dien-4-one (PubChem CID 87880915) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is (12Z,15Z)-5,6-dibutyl-1,2,3-trihydroxyhenicosa-12,15-dien-4-one.
| Compound Name | (12Z,15Z)-5,6-dibutyl-1,2,3-trihydroxyhenicosa-12,15-dien-4-one |
|---|---|
| PubChem CID | 87880915 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | (12Z,15Z)-5,6-dibutyl-1,2,3-trihydroxyhenicosa-12,15-dien-4-one |
| SMILES | CCCCC/C=C\C/C=C\CCCCCC(CCCC)C(CCCC)C(=O)C(O)C(O)CO |
| InChI | InChI=1S/C29H54O4/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-22-25(21-8-5-2)26(23-9-6-3)28(32)29(33)27(31)24-30/h12-13,15-16,25-27,29-31,33H,4-11,14,17-24H2,1-3H3/b13-12-,16-15- |
| InChIKey | KSTLHEIZDOOECO-QGLGPCELSA-N |
| XLogP | 6.92 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|