C26H26F3N3Si2 — CID 157156753
bis(4-fluorophenyl)-[[(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silyl]methyl]-prop-2-enylsilane (PubChem CID 157156753) has the molecular formula C26H26F3N3Si2 and a molecular weight of 493.68 g/mol. Its IUPAC name is bis(4-fluorophenyl)-[[(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silyl]methyl]-prop-2-enylsilane.
| Compound Name | bis(4-fluorophenyl)-[[(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silyl]methyl]-prop-2-enylsilane |
|---|---|
| PubChem CID | 157156753 |
| Molecular Formula | C26H26F3N3Si2 |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | bis(4-fluorophenyl)-[[(4-fluorophenyl)-methyl-(1,2,4-triazol-1-ylmethyl)silyl]methyl]-prop-2-enylsilane |
| SMILES | C=CC[Si](C[Si](C)(Cn1cncn1)c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F3N3Si2/c1-3-16-34(25-12-6-22(28)7-13-25,26-14-8-23(29)9-15-26)20-33(2,19-32-18-30-17-31-32)24-10-4-21(27)5-11-24/h3-15,17-18H,1,16,19-20H2,2H3 |
| InChIKey | ALWYWNUQCPOORJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|