C21H16Cl3N3Si — CID 13474657
tris(4-chlorophenyl)-(1,2,4-triazol-1-ylmethyl)silane (PubChem CID 13474657) has the molecular formula C21H16Cl3N3Si and a molecular weight of 444.83 g/mol. Its IUPAC name is tris(4-chlorophenyl)-(1,2,4-triazol-1-ylmethyl)silane.
| Compound Name | tris(4-chlorophenyl)-(1,2,4-triazol-1-ylmethyl)silane |
|---|---|
| PubChem CID | 13474657 |
| Molecular Formula | C21H16Cl3N3Si |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | tris(4-chlorophenyl)-(1,2,4-triazol-1-ylmethyl)silane |
| SMILES | Clc1ccc([Si](Cn2cncn2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H16Cl3N3Si/c22-16-1-7-19(8-2-16)28(15-27-14-25-13-26-27,20-9-3-17(23)4-10-20)21-11-5-18(24)6-12-21/h1-14H,15H2 |
| InChIKey | OMYRNEQBPXJBQG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|