C14H16ClN3 — CID 175710478
1-[2-(4-chlorophenyl)-3-methylpent-4-enyl]-1,2,4-triazole (PubChem CID 175710478) has the molecular formula C14H16ClN3 and a molecular weight of 261.76 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-3-methylpent-4-enyl]-1,2,4-triazole.
| Compound Name | 1-[2-(4-chlorophenyl)-3-methylpent-4-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 175710478 |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.76 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-3-methylpent-4-enyl]-1,2,4-triazole |
| SMILES | C=CC(C)C(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN3/c1-3-11(2)14(8-18-10-16-9-17-18)12-4-6-13(15)7-5-12/h3-7,9-11,14H,1,8H2,2H3 |
| InChIKey | JCWSQSMOHICXIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|