C16H22ClN3OSi — CID 101049015
2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpent-4-en-1-ol (PubChem CID 101049015) has the molecular formula C16H22ClN3OSi and a molecular weight of 335.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpent-4-en-1-ol.
| Compound Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpent-4-en-1-ol |
|---|---|
| PubChem CID | 101049015 |
| Molecular Formula | C16H22ClN3OSi |
| Molecular Weight | 335.91 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpent-4-en-1-ol |
| SMILES | C=CC(C(c1ccc(Cl)cc1)C(O)n1cncn1)[Si](C)(C)C |
| InChI | InChI=1S/C16H22ClN3OSi/c1-5-14(22(2,3)4)15(12-6-8-13(17)9-7-12)16(21)20-11-18-10-19-20/h5-11,14-16,21H,1H2,2-4H3 |
| InChIKey | IUQCPOKBYYQBBP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|