C15H23N3O2Si — CID 10756992
2-(4-methoxyphenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol (PubChem CID 10756992) has the molecular formula C15H23N3O2Si and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol.
| Compound Name | 2-(4-methoxyphenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
|---|---|
| PubChem CID | 10756992 |
| Molecular Formula | C15H23N3O2Si |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
| SMILES | COc1ccc(C(O)(Cn2cncn2)C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O2Si/c1-20-14-7-5-13(6-8-14)15(19,10-21(2,3)4)9-18-12-16-11-17-18/h5-8,11-12,19H,9-10H2,1-4H3 |
| InChIKey | SOPRGMNDJUZLED-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|